C22H20N4O5S2 — CID 26784289
4-ethoxy-3-methoxy-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]benzohydrazide (PubChem CID 26784289) has the molecular formula C22H20N4O5S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]benzohydrazide.
| Compound Name | 4-ethoxy-3-methoxy-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26784289 |
| Molecular Formula | C22H20N4O5S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 4-ethoxy-3-methoxy-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)cc1OC |
| InChI | InChI=1S/C22H20N4O5S2/c1-3-31-15-7-6-13(9-16(15)30-2)20(28)25-24-18(27)10-26-12-23-21-19(22(26)29)14(11-33-21)17-5-4-8-32-17/h4-9,11-12H,3,10H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | PKNRYGZVTVNDMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|