C21H14N6O4S2 — CID 27565761
4-oxo-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]-3H-phthalazine-1-carbohydrazide (PubChem CID 27565761) has the molecular formula C21H14N6O4S2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-oxo-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]-3H-phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27565761 |
| Molecular Formula | C21H14N6O4S2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 4-oxo-N'-[2-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)acetyl]-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(Cn1cnc2scc(-c3cccs3)c2c1=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H14N6O4S2/c28-15(23-26-19(30)17-11-4-1-2-5-12(11)18(29)25-24-17)8-27-10-22-20-16(21(27)31)13(9-33-20)14-6-3-7-32-14/h1-7,9-10H,8H2,(H,23,28)(H,25,29)(H,26,30) |
| InChIKey | YUZROECUHAUHQT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|