C22H18BrN3O5 — CID 55449570
[1-(2-nitroanilino)-1-oxopropan-2-yl] 6-(3-bromophenyl)-2-methylpyridine-3-carboxylate (PubChem CID 55449570) has the molecular formula C22H18BrN3O5 and a molecular weight of 484.31 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-(3-bromophenyl)-2-methylpyridine-3-carboxylate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-(3-bromophenyl)-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55449570 |
| Molecular Formula | C22H18BrN3O5 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-(3-bromophenyl)-2-methylpyridine-3-carboxylate |
| SMILES | Cc1nc(-c2cccc(Br)c2)ccc1C(=O)OC(C)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18BrN3O5/c1-13-17(10-11-18(24-13)15-6-5-7-16(23)12-15)22(28)31-14(2)21(27)25-19-8-3-4-9-20(19)26(29)30/h3-12,14H,1-2H3,(H,25,27) |
| InChIKey | DBKMTKBONPQQNH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|