C18H22IN3O5 — CID 55452209
1-[4-[2-(4-iodophenoxy)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55452209) has the molecular formula C18H22IN3O5 and a molecular weight of 487.29 g/mol. Its IUPAC name is 1-[4-[2-(4-iodophenoxy)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-[2-(4-iodophenoxy)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55452209 |
| Molecular Formula | C18H22IN3O5 |
| Molecular Weight | 487.29 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 1-[4-[2-(4-iodophenoxy)acetyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | O=C(COc1ccc(I)cc1)N1CCN(C(=O)C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C18H22IN3O5/c19-14-1-3-15(4-2-14)27-13-16(23)20-5-7-21(8-6-20)17(24)18(25)22-9-11-26-12-10-22/h1-4H,5-13H2 |
| InChIKey | BTYOORDZTFDODF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|