C18H23N5O2S2 — CID 55452303
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide (PubChem CID 55452303) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55452303 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-[3-methylsulfanyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]acetamide |
| SMILES | CSCCC(NC(=O)CSCc1c(C)noc1C)c1nnc2ccccn12 |
| InChI | InChI=1S/C18H23N5O2S2/c1-12-14(13(2)25-22-12)10-27-11-17(24)19-15(7-9-26-3)18-21-20-16-6-4-5-8-23(16)18/h4-6,8,15H,7,9-11H2,1-3H3,(H,19,24) |
| InChIKey | LJNQVMJXSATRBZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |