C11H14O2 — CID 554537
9-methoxytricyclo[5.2.1.04,10]dec-5-en-2-one (PubChem CID 554537) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 9-methoxytricyclo[5.2.1.04,10]dec-5-en-2-one.
| Compound Name | 9-methoxytricyclo[5.2.1.04,10]dec-5-en-2-one |
|---|---|
| PubChem CID | 554537 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 9-methoxytricyclo[5.2.1.04,10]dec-5-en-2-one |
| SMILES | COC1CC2C=CC3CC(=O)C1C32 |
| InChI | InChI=1S/C11H14O2/c1-13-9-5-7-3-2-6-4-8(12)11(9)10(6)7/h2-3,6-7,9-11H,4-5H2,1H3 |
| InChIKey | ZZKMVTGDZKHJGY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|