C23H29N3O3S — CID 55454179
5-(1,3-benzothiazol-2-yl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pentanamide (PubChem CID 55454179) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pentanamide |
|---|---|
| PubChem CID | 55454179 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]pentanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCCCc2nc3ccccc3s2)N2CCOCC2)o1 |
| InChI | InChI=1S/C23H29N3O3S/c1-17-10-11-20(29-17)19(26-12-14-28-15-13-26)16-24-22(27)8-4-5-9-23-25-18-6-2-3-7-21(18)30-23/h2-3,6-7,10-11,19H,4-5,8-9,12-16H2,1H3,(H,24,27) |
| InChIKey | WUIUISVFEUZNQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|