C24H32N4O7 — CID 55454563
propan-2-yl 3-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55454563) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55454563 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | propan-2-yl 3-[[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NC(CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C24H32N4O7/c1-4-16-9-11-24(12-10-16)22(31)27(23(32)26-24)14-20(29)25-18(13-21(30)35-15(2)3)17-7-5-6-8-19(17)28(33)34/h5-8,15-16,18H,4,9-14H2,1-3H3,(H,25,29)(H,26,32) |
| InChIKey | LTWLLVRTYDXATF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|