C19H24N4O6S — CID 55454599
5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-N,N-diethyl-1-methylpyrrole-3-sulfonamide (PubChem CID 55454599) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-N,N-diethyl-1-methylpyrrole-3-sulfonamide.
| Compound Name | 5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-N,N-diethyl-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 55454599 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)carbamoyl]-N,N-diethyl-1-methylpyrrole-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NNC(=O)c2ccc3c(c2)OCCO3)n(C)c1 |
| InChI | InChI=1S/C19H24N4O6S/c1-4-23(5-2)30(26,27)14-11-15(22(3)12-14)19(25)21-20-18(24)13-6-7-16-17(10-13)29-9-8-28-16/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | KLKJJXJESXUXAT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|