C18H17FN2O4S — CID 55454751
N'-[3-(2-fluorophenyl)sulfanylpropanoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (PubChem CID 55454751) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is N'-[3-(2-fluorophenyl)sulfanylpropanoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide.
| Compound Name | N'-[3-(2-fluorophenyl)sulfanylpropanoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
|---|---|
| PubChem CID | 55454751 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N'-[3-(2-fluorophenyl)sulfanylpropanoyl]-2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| SMILES | O=C(CCSc1ccccc1F)NNC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17FN2O4S/c19-13-3-1-2-4-16(13)26-10-7-17(22)20-21-18(23)12-5-6-14-15(11-12)25-9-8-24-14/h1-6,11H,7-10H2,(H,20,22)(H,21,23) |
| InChIKey | BWFGPYYPIGRCRF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|