C21H22FN3O6S — CID 55455092
N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 55455092) has the molecular formula C21H22FN3O6S and a molecular weight of 463.49 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55455092 |
| Molecular Formula | C21H22FN3O6S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H22FN3O6S/c22-16-3-1-2-4-19(16)32(28,29)25-9-7-14(8-10-25)20(26)23-24-21(27)15-5-6-17-18(13-15)31-12-11-30-17/h1-6,13-14H,7-12H2,(H,23,26)(H,24,27) |
| InChIKey | UGDKZHGNYULMBW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|