C27H27N3O6 — CID 55458696
[2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 55458696) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 55458696 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [2-oxo-2-(3-oxospiro[4H-quinoxaline-2,1'-cyclopentane]-1-yl)ethyl] 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)OCC(=O)N1c3ccccc3NC(=O)C13CCCC3)C2=O |
| InChI | InChI=1S/C27H27N3O6/c1-17-10-11-18-19(15-17)25(34)29(24(18)33)14-6-9-23(32)36-16-22(31)30-21-8-3-2-7-20(21)28-26(35)27(30)12-4-5-13-27/h2-3,7-8,10-11,15H,4-6,9,12-14,16H2,1H3,(H,28,35) |
| InChIKey | IAIHXVAOZHNVIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|