C24H23N3O4 — CID 55459343
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate (PubChem CID 55459343) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 55459343 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)CCn1cnc2c(C)cccc2c1=O |
| InChI | InChI=1S/C24H23N3O4/c1-14-7-6-9-18-22(14)25-13-27(24(18)30)12-11-20(28)31-16(3)23(29)21-15(2)26-19-10-5-4-8-17(19)21/h4-10,13,16,26H,11-12H2,1-3H3 |
| InChIKey | IHSGXUSVVQIWGH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |