C27H24N2O5S — CID 55460140
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-benzamido-2-phenylacetate (PubChem CID 55460140) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-benzamido-2-phenylacetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 55460140 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2-benzamido-2-phenylacetate |
| SMILES | COc1ccc(-c2nc(COC(=O)C(NC(=O)c3ccccc3)c3ccccc3)cs2)cc1OC |
| InChI | InChI=1S/C27H24N2O5S/c1-32-22-14-13-20(15-23(22)33-2)26-28-21(17-35-26)16-34-27(31)24(18-9-5-3-6-10-18)29-25(30)19-11-7-4-8-12-19/h3-15,17,24H,16H2,1-2H3,(H,29,30) |
| InChIKey | MATDKYMNMKAMCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |