C29H29N3O2 — CID 55460519
[3-(2-methylphenyl)-1-phenylpyrazol-4-yl]-(4-phenylmethoxypiperidin-1-yl)methanone (PubChem CID 55460519) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [3-(2-methylphenyl)-1-phenylpyrazol-4-yl]-(4-phenylmethoxypiperidin-1-yl)methanone.
| Compound Name | [3-(2-methylphenyl)-1-phenylpyrazol-4-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55460519 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [3-(2-methylphenyl)-1-phenylpyrazol-4-yl]-(4-phenylmethoxypiperidin-1-yl)methanone |
| SMILES | Cc1ccccc1-c1nn(-c2ccccc2)cc1C(=O)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N3O2/c1-22-10-8-9-15-26(22)28-27(20-32(30-28)24-13-6-3-7-14-24)29(33)31-18-16-25(17-19-31)34-21-23-11-4-2-5-12-23/h2-15,20,25H,16-19,21H2,1H3 |
| InChIKey | UMHRSLRDCCQBQT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |