C26H30N4O4S — CID 55460888
2-[4-[2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 55460888) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[4-[2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55460888 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[4-[2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)N1CCN(C(=O)c2ccccc2SCC(=O)N2CCc3ccccc32)CC1 |
| InChI | InChI=1S/C26H30N4O4S/c1-18(2)27-24(32)26(34)29-15-13-28(14-16-29)25(33)20-8-4-6-10-22(20)35-17-23(31)30-12-11-19-7-3-5-9-21(19)30/h3-10,18H,11-17H2,1-2H3,(H,27,32) |
| InChIKey | LUSXLVWUAUHTJV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|