C25H36N4O4S — CID 55460390
2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 55460390) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55460390 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)N1CCN(C(=O)c2ccccc2SCC(=O)NCC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H36N4O4S/c1-18(2)27-23(31)25(33)29-14-12-28(13-15-29)24(32)20-10-6-7-11-21(20)34-17-22(30)26-16-19-8-4-3-5-9-19/h6-7,10-11,18-19H,3-5,8-9,12-17H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | NLZGRIKSWYQANW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|