C25H34N4O4S — CID 55800356
2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide (PubChem CID 55800356) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide.
| Compound Name | 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide |
|---|---|
| PubChem CID | 55800356 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[4-[2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide |
| SMILES | O=C(CSc1ccccc1C(=O)N1CCN(C(=O)C(=O)NC2CC2)CC1)NCC1CCCCC1 |
| InChI | InChI=1S/C25H34N4O4S/c30-22(26-16-18-6-2-1-3-7-18)17-34-21-9-5-4-8-20(21)24(32)28-12-14-29(15-13-28)25(33)23(31)27-19-10-11-19/h4-5,8-9,18-19H,1-3,6-7,10-17H2,(H,26,30)(H,27,31) |
| InChIKey | SGXLDJVVIFGTRF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|