C25H37N3O2S — CID 86860207
2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)phenyl]sulfanyl-N-cyclooctylacetamide (PubChem CID 86860207) has the molecular formula C25H37N3O2S and a molecular weight of 443.66 g/mol. Its IUPAC name is 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)phenyl]sulfanyl-N-cyclooctylacetamide.
| Compound Name | 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)phenyl]sulfanyl-N-cyclooctylacetamide |
|---|---|
| PubChem CID | 86860207 |
| Molecular Formula | C25H37N3O2S |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)phenyl]sulfanyl-N-cyclooctylacetamide |
| SMILES | O=C(CSc1ccccc1C(=O)N1CCN2CCCCC2C1)NC1CCCCCCC1 |
| InChI | InChI=1S/C25H37N3O2S/c29-24(26-20-10-4-2-1-3-5-11-20)19-31-23-14-7-6-13-22(23)25(30)28-17-16-27-15-9-8-12-21(27)18-28/h6-7,13-14,20-21H,1-5,8-12,15-19H2,(H,26,29) |
| InChIKey | ZITSRZMFZWMEFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |