C20H27N3O3S — CID 55464857
(Z)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 55464857) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55464857 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (Z)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)N(C2CC2)C2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C20H27N3O3S/c1-4-8-22-14(2)10-16(15(22)3)11-17(12-21)20(24)23(18-5-6-18)19-7-9-27(25,26)13-19/h10-11,18-19H,4-9,13H2,1-3H3/b17-11- |
| InChIKey | RZJFWFPZENSVLK-BOPFTXTBSA-N |
| XLogP | 2.60 |
| TPSA | 83.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|