C25H34N4O5 — CID 55475100
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55475100) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55475100 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)N(C)C2(CCCCC2)C1=O)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N4O5/c1-19(22(31)28-15-13-27(14-16-28)17-20-9-5-3-6-10-20)34-21(30)18-29-23(32)25(26(2)24(29)33)11-7-4-8-12-25/h3,5-6,9-10,19H,4,7-8,11-18H2,1-2H3 |
| InChIKey | GOMMOQCHKWUSBH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|