C20H21NO4S — CID 55479076
[2-(2-methylmorpholin-4-yl)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 55479076) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is [2-(2-methylmorpholin-4-yl)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55479076 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | CC1CN(C(=O)COC(=O)/C=C/c2ccc(-c3ccccc3)s2)CCO1 |
| InChI | InChI=1S/C20H21NO4S/c1-15-13-21(11-12-24-15)19(22)14-25-20(23)10-8-17-7-9-18(26-17)16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3/b10-8+ |
| InChIKey | BZKKVTFJHIEPRP-CSKARUKUSA-N |
| XLogP | 3.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|