C17H14F3NO3S — CID 8515949
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 8515949) has the molecular formula C17H14F3NO3S and a molecular weight of 369.36 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8515949 |
| Molecular Formula | C17H14F3NO3S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(-c2ccccc2)s1)NCC(F)(F)F |
| InChI | InChI=1S/C17H14F3NO3S/c18-17(19,20)11-21-15(22)10-24-16(23)9-7-13-6-8-14(25-13)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,21,22)/b9-7+ |
| InChIKey | YQRZUGQIZURLDD-VQHVLOKHSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|