C26H26N2O4S — CID 27800204
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 27800204) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 27800204 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COC(=O)/C=C/c2ccc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-3-28(4-2)26(31)20-10-12-21(13-11-20)27-24(29)18-32-25(30)17-15-22-14-16-23(33-22)19-8-6-5-7-9-19/h5-17H,3-4,18H2,1-2H3,(H,27,29)/b17-15+ |
| InChIKey | UVOYNXBJGSIGFG-BMRADRMJSA-N |
| XLogP | 5.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|