C21H16N2O5S — CID 8515749
[2-(2-nitroanilino)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 8515749) has the molecular formula C21H16N2O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8515749 |
| Molecular Formula | C21H16N2O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(-c2ccccc2)s1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N2O5S/c24-20(22-17-8-4-5-9-18(17)23(26)27)14-28-21(25)13-11-16-10-12-19(29-16)15-6-2-1-3-7-15/h1-13H,14H2,(H,22,24)/b13-11+ |
| InChIKey | BCQVAHHBDBVLPN-ACCUITESSA-N |
| XLogP | 4.52 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|