C18H14N2O5S — CID 98436124
[2-oxo-2-(prop-2-ynylamino)ethyl] (Z)-3-[5-(2-nitrophenyl)thiophen-2-yl]prop-2-enoate (PubChem CID 98436124) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (Z)-3-[5-(2-nitrophenyl)thiophen-2-yl]prop-2-enoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (Z)-3-[5-(2-nitrophenyl)thiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 98436124 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (Z)-3-[5-(2-nitrophenyl)thiophen-2-yl]prop-2-enoate |
| SMILES | C#CCNC(=O)COC(=O)/C=C\c1ccc(-c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C18H14N2O5S/c1-2-11-19-17(21)12-25-18(22)10-8-13-7-9-16(26-13)14-5-3-4-6-15(14)20(23)24/h1,3-10H,11-12H2,(H,19,21)/b10-8- |
| InChIKey | WECQGNBQSCSXRI-NTMALXAHSA-N |
| XLogP | 2.63 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|