C17H15F3N2O4S — CID 75447975
(E)-N-methyl-3-[5-(2-nitrophenyl)thiophen-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide (PubChem CID 75447975) has the molecular formula C17H15F3N2O4S and a molecular weight of 400.38 g/mol. Its IUPAC name is (E)-N-methyl-3-[5-(2-nitrophenyl)thiophen-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-N-methyl-3-[5-(2-nitrophenyl)thiophen-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 75447975 |
| Molecular Formula | C17H15F3N2O4S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (E)-N-methyl-3-[5-(2-nitrophenyl)thiophen-2-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
| SMILES | CN(CC(O)C(F)(F)F)C(=O)/C=C/c1ccc(-c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C17H15F3N2O4S/c1-21(10-15(23)17(18,19)20)16(24)9-7-11-6-8-14(27-11)12-4-2-3-5-13(12)22(25)26/h2-9,15,23H,10H2,1H3/b9-7+ |
| InChIKey | NSWZUECDLACOKR-VQHVLOKHSA-N |
| XLogP | 3.72 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|