C12H10F3N3O3 — CID 99705763
(2R)-1,1,1-trifluoro-3-[4-(2-nitrophenyl)pyrazol-1-yl]propan-2-ol (PubChem CID 99705763) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[4-(2-nitrophenyl)pyrazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[4-(2-nitrophenyl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 99705763 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[4-(2-nitrophenyl)pyrazol-1-yl]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccccc1-c1cnn(C[C@@H](O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N3O3/c13-12(14,15)11(19)7-17-6-8(5-16-17)9-3-1-2-4-10(9)18(20)21/h1-6,11,19H,7H2/t11-/m1/s1 |
| InChIKey | VYRVMJMJHGERAY-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|