About ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol
ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol (PubChem CID 145015043) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol |
| PubChem CID | 145015043 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol |
| SMILES | CC.Cc1cnn(CC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C7H9F3N2O.C2H6/c1-5-2-11-12(3-5)4-6(13)7(8,9)10;1-2/h2-3,6,13H,4H2,1H3;1-2H3 |
| InChIKey | XWNBVDLUWWJGRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol?
The IUPAC name of ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol (CID 145015043) is ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol.
What is the SMILES notation for ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol?
The canonical SMILES for ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol is CC.Cc1cnn(CC(O)C(F)(F)F)c1.
What is the InChIKey of ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol?
The InChIKey is XWNBVDLUWWJGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O.C2H6/c1-5-2-11-12(3-5)4-6(13)7(8,9)10;1-2/h2-3,6,13H,4H2,1H3;1-2H3.
What are the key properties of ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol?
ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol has a molecular weight of 224.23 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,1,1-trifluoro-3-(4-methylpyrazol-1-yl)propan-2-ol is sourced from PubChem (CID 145015043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).