C20H21NO5S2 — CID 8516293
[2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate (PubChem CID 8516293) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate.
| Compound Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8516293 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(5-phenylthiophen-2-yl)prop-2-enoate |
| SMILES | C[C@]1(NC(=O)COC(=O)/C=C/c2ccc(-c3ccccc3)s2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H21NO5S2/c1-20(11-12-28(24,25)14-20)21-18(22)13-26-19(23)10-8-16-7-9-17(27-16)15-5-3-2-4-6-15/h2-10H,11-14H2,1H3,(H,21,22)/b10-8+/t20-/m0/s1 |
| InChIKey | XOWWOXQDKVLAIW-MFUYTVRRSA-N |
| XLogP | 2.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|