C14H17NO5S2 — CID 8648079
[2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648079) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648079 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | C[C@@]1(NC(=O)COC(=O)/C=C/c2cccs2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17NO5S2/c1-14(6-8-22(18,19)10-14)15-12(16)9-20-13(17)5-4-11-3-2-7-21-11/h2-5,7H,6,8-10H2,1H3,(H,15,16)/b5-4+/t14-/m1/s1 |
| InChIKey | JCMYBEUAEJOYPJ-ISZGNANSSA-N |
| XLogP | 1.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|