C25H21F2N3O2 — CID 55483076
2-(3,4-difluorophenyl)-N-methyl-2-[[2-(2-phenylindol-1-yl)acetyl]amino]acetamide (PubChem CID 55483076) has the molecular formula C25H21F2N3O2 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-methyl-2-[[2-(2-phenylindol-1-yl)acetyl]amino]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-methyl-2-[[2-(2-phenylindol-1-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 55483076 |
| Molecular Formula | C25H21F2N3O2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-methyl-2-[[2-(2-phenylindol-1-yl)acetyl]amino]acetamide |
| SMILES | CNC(=O)C(NC(=O)Cn1c(-c2ccccc2)cc2ccccc21)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H21F2N3O2/c1-28-25(32)24(18-11-12-19(26)20(27)13-18)29-23(31)15-30-21-10-6-5-9-17(21)14-22(30)16-7-3-2-4-8-16/h2-14,24H,15H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | KDFHFDYIPMZCSB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |