C31H28N2O — CID 155968281
2-(2-phenylindol-1-yl)-N-[1-(4-phenylphenyl)propan-2-yl]acetamide (PubChem CID 155968281) has the molecular formula C31H28N2O and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(2-phenylindol-1-yl)-N-[1-(4-phenylphenyl)propan-2-yl]acetamide.
| Compound Name | 2-(2-phenylindol-1-yl)-N-[1-(4-phenylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 155968281 |
| Molecular Formula | C31H28N2O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-(2-phenylindol-1-yl)-N-[1-(4-phenylphenyl)propan-2-yl]acetamide |
| SMILES | CC(Cc1ccc(-c2ccccc2)cc1)NC(=O)Cn1c(-c2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C31H28N2O/c1-23(20-24-16-18-26(19-17-24)25-10-4-2-5-11-25)32-31(34)22-33-29-15-9-8-14-28(29)21-30(33)27-12-6-3-7-13-27/h2-19,21,23H,20,22H2,1H3,(H,32,34) |
| InChIKey | UUVBGAFZFJJFEZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |