C20H24N4O4S2 — CID 55484381
N-(benzylcarbamoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 55484381) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | N-(benzylcarbamoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 55484381 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-(benzylcarbamoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | O=C(CCSc1ccc(S(=O)(=O)N2CCCC2)cn1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H24N4O4S2/c25-18(23-20(26)22-14-16-6-2-1-3-7-16)10-13-29-19-9-8-17(15-21-19)30(27,28)24-11-4-5-12-24/h1-3,6-9,15H,4-5,10-14H2,(H2,22,23,25,26) |
| InChIKey | RGAQJIGSZRRSFU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |