C24H24N4O3S — CID 55491631
[1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 55491631) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is [1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | [1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 55491631 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidin-4-yl]-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(C1CCN(C2=NS(=O)(=O)c3ccccc32)CC1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C24H24N4O3S/c29-24(28-14-11-21-19(15-28)17-5-1-3-7-20(17)25-21)16-9-12-27(13-10-16)23-18-6-2-4-8-22(18)32(30,31)26-23/h1-8,16,25H,9-15H2 |
| InChIKey | JJSWXXNKOPZJCO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|