C20H24FN3OS — CID 55495175
N-[(4-fluorophenyl)methyl]-1,3-dimethyl-N-pentylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 55495175) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1,3-dimethyl-N-pentylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1,3-dimethyl-N-pentylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55495175 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1,3-dimethyl-N-pentylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)c1cc2c(C)nn(C)c2s1 |
| InChI | InChI=1S/C20H24FN3OS/c1-4-5-6-11-24(13-15-7-9-16(21)10-8-15)19(25)18-12-17-14(2)22-23(3)20(17)26-18/h7-10,12H,4-6,11,13H2,1-3H3 |
| InChIKey | ABUMFXNJGFGWNT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|