C17H21FN2O2 — CID 78810477
N-[(4-fluorophenyl)methyl]-3-methyl-N-pentyl-1,2-oxazole-5-carboxamide (PubChem CID 78810477) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methyl-N-pentyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methyl-N-pentyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 78810477 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methyl-N-pentyl-1,2-oxazole-5-carboxamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)c1cc(C)no1 |
| InChI | InChI=1S/C17H21FN2O2/c1-3-4-5-10-20(12-14-6-8-15(18)9-7-14)17(21)16-11-13(2)19-22-16/h6-9,11H,3-5,10,12H2,1-2H3 |
| InChIKey | PCPLHPNGYZOMLK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|