C22H26FNO3 — CID 55756438
N-[(4-fluorophenyl)methyl]-3-methyl-4-oxo-N-pentyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 55756438) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methyl-4-oxo-N-pentyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methyl-4-oxo-N-pentyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55756438 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methyl-4-oxo-N-pentyl-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)C(=O)c1oc2c(c1C)C(=O)CCC2 |
| InChI | InChI=1S/C22H26FNO3/c1-3-4-5-13-24(14-16-9-11-17(23)12-10-16)22(26)21-15(2)20-18(25)7-6-8-19(20)27-21/h9-12H,3-8,13-14H2,1-2H3 |
| InChIKey | LTPGUINDJJIVHB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|