C22H28N2O3S — CID 55495250
N,N-diethyl-2-methyl-5-(2-phenylpyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 55495250) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-5-(2-phenylpyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-2-methyl-5-(2-phenylpyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55495250 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N,N-diethyl-2-methyl-5-(2-phenylpyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N2CCCC2c2ccccc2)ccc1C |
| InChI | InChI=1S/C22H28N2O3S/c1-4-23(5-2)28(26,27)21-16-19(14-13-17(21)3)22(25)24-15-9-12-20(24)18-10-7-6-8-11-18/h6-8,10-11,13-14,16,20H,4-5,9,12,15H2,1-3H3 |
| InChIKey | UAGGZBHAMJIGML-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |