C25H25FN2O3S — CID 55530086
N-ethyl-3-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-N-phenylbenzenesulfonamide (PubChem CID 55530086) has the molecular formula C25H25FN2O3S and a molecular weight of 452.55 g/mol. Its IUPAC name is N-ethyl-3-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-N-phenylbenzenesulfonamide.
| Compound Name | N-ethyl-3-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 55530086 |
| Molecular Formula | C25H25FN2O3S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-ethyl-3-[2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)N2CCCC2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H25FN2O3S/c1-2-28(22-9-4-3-5-10-22)32(30,31)23-11-6-8-20(18-23)25(29)27-17-7-12-24(27)19-13-15-21(26)16-14-19/h3-6,8-11,13-16,18,24H,2,7,12,17H2,1H3 |
| InChIKey | VKFIPXYVZLJRGY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |