C23H23N3O3S — CID 34477512
N-methyl-N-phenyl-3-[(2S)-2-pyridin-3-ylpyrrolidine-1-carbonyl]benzenesulfonamide (PubChem CID 34477512) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-methyl-N-phenyl-3-[(2S)-2-pyridin-3-ylpyrrolidine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-methyl-N-phenyl-3-[(2S)-2-pyridin-3-ylpyrrolidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34477512 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-methyl-N-phenyl-3-[(2S)-2-pyridin-3-ylpyrrolidine-1-carbonyl]benzenesulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)N2CCC[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-25(20-10-3-2-4-11-20)30(28,29)21-12-5-8-18(16-21)23(27)26-15-7-13-22(26)19-9-6-14-24-17-19/h2-6,8-12,14,16-17,22H,7,13,15H2,1H3/t22-/m0/s1 |
| InChIKey | QRUYZTAIUNJHPE-QFIPXVFZSA-N |
| XLogP | 3.88 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |