C22H21ClN2O3S2 — CID 55722334
N-(3-chlorophenyl)-N-methyl-3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 55722334) has the molecular formula C22H21ClN2O3S2 and a molecular weight of 461.01 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-methyl-3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-N-methyl-3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55722334 |
| Molecular Formula | C22H21ClN2O3S2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-(3-chlorophenyl)-N-methyl-3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)N2CCCC2c2ccsc2)c1 |
| InChI | InChI=1S/C22H21ClN2O3S2/c1-24(19-7-3-6-18(23)14-19)30(27,28)20-8-2-5-16(13-20)22(26)25-11-4-9-21(25)17-10-12-29-15-17/h2-3,5-8,10,12-15,21H,4,9,11H2,1H3 |
| InChIKey | NQIFPHDIKDZCRM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |