C18H21N5OS2 — CID 55497388
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 55497388) has the molecular formula C18H21N5OS2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 55497388 |
| Molecular Formula | C18H21N5OS2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCc1nc(SCC(=O)Nc2nc(-c3cc(C)c(C)cc3C)cs2)n[nH]1 |
| InChI | InChI=1S/C18H21N5OS2/c1-5-15-20-18(23-22-15)26-9-16(24)21-17-19-14(8-25-17)13-7-11(3)10(2)6-12(13)4/h6-8H,5,9H2,1-4H3,(H,19,21,24)(H,20,22,23) |
| InChIKey | WDLGQWVPNGWCDS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |