C16H27N5O4S2 — CID 55498848
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 55498848) has the molecular formula C16H27N5O4S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55498848 |
| Molecular Formula | C16H27N5O4S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)NC(=O)NCc2cccs2)CC1 |
| InChI | InChI=1S/C16H27N5O4S2/c1-3-20(4-2)27(24,25)21-9-7-19(8-10-21)13-15(22)18-16(23)17-12-14-6-5-11-26-14/h5-6,11H,3-4,7-10,12-13H2,1-2H3,(H2,17,18,22,23) |
| InChIKey | UBBXJORRWASRGJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |