C15H22N4O4S — CID 9431083
ethyl 4-[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl]piperazine-1-carboxylate (PubChem CID 9431083) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 9431083 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl 4-[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)NC(=O)NCc2cccs2)CC1 |
| InChI | InChI=1S/C15H22N4O4S/c1-2-23-15(22)19-7-5-18(6-8-19)11-13(20)17-14(21)16-10-12-4-3-9-24-12/h3-4,9H,2,5-8,10-11H2,1H3,(H2,16,17,20,21) |
| InChIKey | RFYDVOJYLCFQOI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |