C26H34N4O4S — CID 55501544
4-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-phenylpiperidine-1-carboxamide (PubChem CID 55501544) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 55501544 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)NC2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O4S/c1-29(23-10-6-3-7-11-23)35(33,34)24-14-12-20(13-15-24)25(31)27-22-16-18-30(19-17-22)26(32)28-21-8-4-2-5-9-21/h2,4-5,8-9,12-15,22-23H,3,6-7,10-11,16-19H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | WWQDIXSNXAFILM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |