C23H30N4O4S — CID 46700441
4-[[4-(butan-2-ylsulfamoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide (PubChem CID 46700441) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 4-[[4-(butan-2-ylsulfamoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[[4-(butan-2-ylsulfamoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 46700441 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-[[4-(butan-2-ylsulfamoyl)benzoyl]amino]-N-phenylpiperidine-1-carboxamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)NC2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O4S/c1-3-17(2)26-32(30,31)21-11-9-18(10-12-21)22(28)24-20-13-15-27(16-14-20)23(29)25-19-7-5-4-6-8-19/h4-12,17,20,26H,3,13-16H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | AYHBEKSGJZPYMS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |