C24H35N3O5S — CID 55509000
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55509000) has the molecular formula C24H35N3O5S and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55509000 |
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyl-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)S(=O)(=O)CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C24H35N3O5S/c1-4-27(33(30,31)17-24-10-9-18(15-21(24)28)23(24,2)3)16-22(29)25-19-5-7-20(8-6-19)26-11-13-32-14-12-26/h5-8,18H,4,9-17H2,1-3H3,(H,25,29) |
| InChIKey | CZQIMBKNGPSGPS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|