C20H20ClN3O4 — CID 55509492
N-[4-[[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 55509492) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is N-[4-[[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55509492 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[4-[[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(CNC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-13(2)20(26)23-16-7-3-15(4-8-16)12-22-19(25)10-6-14-5-9-17(21)18(11-14)24(27)28/h3-11,13H,12H2,1-2H3,(H,22,25)(H,23,26)/b10-6+ |
| InChIKey | NTYCJRZGFPFJRJ-UXBLZVDNSA-N |
| XLogP | 4.17 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|