C25H18FN3O4S — CID 55510277
6-[(4-fluorophenyl)sulfamoyl]-2-oxo-N-(3-phenylprop-2-ynyl)-1H-quinoline-4-carboxamide (PubChem CID 55510277) has the molecular formula C25H18FN3O4S and a molecular weight of 475.50 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)sulfamoyl]-2-oxo-N-(3-phenylprop-2-ynyl)-1H-quinoline-4-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)sulfamoyl]-2-oxo-N-(3-phenylprop-2-ynyl)-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55510277 |
| Molecular Formula | C25H18FN3O4S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 6-[(4-fluorophenyl)sulfamoyl]-2-oxo-N-(3-phenylprop-2-ynyl)-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1cc(=O)[nH]c2ccc(S(=O)(=O)Nc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C25H18FN3O4S/c26-18-8-10-19(11-9-18)29-34(32,33)20-12-13-23-21(15-20)22(16-24(30)28-23)25(31)27-14-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-13,15-16,29H,14H2,(H,27,31)(H,28,30) |
| InChIKey | BPZQOAHNCLUXJE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|